4-({2-[(4-methylphenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-bromobenzoate
Chemical Structure Depiction of
4-({2-[(4-methylphenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-bromobenzoate
4-({2-[(4-methylphenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-bromobenzoate
Compound characteristics
| Compound ID: | 8005-7112 |
| Compound Name: | 4-({2-[(4-methylphenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-bromobenzoate |
| Molecular Weight: | 467.32 |
| Molecular Formula: | C23 H19 Br N2 O4 |
| Smiles: | Cc1ccc(cc1)OCC(N/N=C/c1ccc(cc1)OC(c1ccccc1[Br])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.833 |
| logD: | 4.8327 |
| logSw: | -4.6301 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.218 |
| InChI Key: | CUPZYLAUMQGRCP-UHFFFAOYSA-N |