4-({2-[(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene}methyl)-2-methoxyphenyl 2-iodobenzoate
Chemical Structure Depiction of
4-({2-[(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene}methyl)-2-methoxyphenyl 2-iodobenzoate
4-({2-[(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene}methyl)-2-methoxyphenyl 2-iodobenzoate
Compound characteristics
| Compound ID: | 8005-7145 |
| Compound Name: | 4-({2-[(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene}methyl)-2-methoxyphenyl 2-iodobenzoate |
| Molecular Weight: | 643.66 |
| Molecular Formula: | C23 H17 Br Cl I N2 O5 |
| Smiles: | COc1cc(/C=N/NC(COc2ccc(cc2[Br])[Cl])=O)ccc1OC(c1ccccc1I)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8966 |
| logD: | 5.8965 |
| logSw: | -6.1164 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.021 |
| InChI Key: | ZCKVPFDCNLRORF-UHFFFAOYSA-N |