2-methoxy-4-({2-[(4-methylphenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-bromobenzoate
Chemical Structure Depiction of
2-methoxy-4-({2-[(4-methylphenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-bromobenzoate
2-methoxy-4-({2-[(4-methylphenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-bromobenzoate
Compound characteristics
| Compound ID: | 8005-7178 |
| Compound Name: | 2-methoxy-4-({2-[(4-methylphenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-bromobenzoate |
| Molecular Weight: | 497.34 |
| Molecular Formula: | C24 H21 Br N2 O5 |
| Smiles: | Cc1ccc(cc1)OCC(N/N=C/c1ccc(c(c1)OC)OC(c1ccccc1[Br])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9615 |
| logD: | 4.9613 |
| logSw: | -4.6803 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.935 |
| InChI Key: | BGKPAYCADLWBCO-UHFFFAOYSA-N |