4-bromo-2-({2-[(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-chlorobenzoate
Chemical Structure Depiction of
4-bromo-2-({2-[(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-chlorobenzoate
4-bromo-2-({2-[(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-chlorobenzoate
Compound characteristics
| Compound ID: | 8005-7334 |
| Compound Name: | 4-bromo-2-({2-[(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-chlorobenzoate |
| Molecular Weight: | 611.63 |
| Molecular Formula: | C22 H14 Br2 Cl N3 O6 |
| Smiles: | C(C(N/N=C/c1cc(ccc1OC(c1ccccc1[Cl])=O)[Br])=O)Oc1ccc(cc1[Br])[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 6.4617 |
| logD: | 6.4571 |
| logSw: | -6.2095 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 96.773 |
| InChI Key: | CKBYNNXNRNCWGA-UHFFFAOYSA-N |