2-(3,4-dimethylphenoxy)-N'-[3-(furan-2-yl)prop-2-en-1-ylidene]acetohydrazide
Chemical Structure Depiction of
2-(3,4-dimethylphenoxy)-N'-[3-(furan-2-yl)prop-2-en-1-ylidene]acetohydrazide
2-(3,4-dimethylphenoxy)-N'-[3-(furan-2-yl)prop-2-en-1-ylidene]acetohydrazide
Compound characteristics
| Compound ID: | 8005-7362 |
| Compound Name: | 2-(3,4-dimethylphenoxy)-N'-[3-(furan-2-yl)prop-2-en-1-ylidene]acetohydrazide |
| Molecular Weight: | 298.34 |
| Molecular Formula: | C17 H18 N2 O3 |
| Smiles: | Cc1ccc(cc1C)OCC(N/N=C/C=C/c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0871 |
| logD: | 3.0867 |
| logSw: | -3.1395 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.22 |
| InChI Key: | IFVICWZVVFQZIB-UHFFFAOYSA-N |