4-bromo-2-chloro-6-({[4-hydroxy-3-(5-methyl-1H-benzimidazol-2-yl)phenyl]imino}methyl)phenol
Chemical Structure Depiction of
4-bromo-2-chloro-6-({[4-hydroxy-3-(5-methyl-1H-benzimidazol-2-yl)phenyl]imino}methyl)phenol
4-bromo-2-chloro-6-({[4-hydroxy-3-(5-methyl-1H-benzimidazol-2-yl)phenyl]imino}methyl)phenol
Compound characteristics
| Compound ID: | 8005-7531 |
| Compound Name: | 4-bromo-2-chloro-6-({[4-hydroxy-3-(5-methyl-1H-benzimidazol-2-yl)phenyl]imino}methyl)phenol |
| Molecular Weight: | 456.72 |
| Molecular Formula: | C21 H15 Br Cl N3 O2 |
| Smiles: | Cc1ccc2c(c1)nc(c1cc(ccc1O)/N=C/c1cc(cc(c1O)[Cl])[Br])[nH]2 |
| Stereo: | ACHIRAL |
| logP: | 6.6872 |
| logD: | 6.1424 |
| logSw: | -6.2763 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 59.413 |
| InChI Key: | GGEANYDVTYGXEQ-UHFFFAOYSA-N |