N'-({2-[bis(2-methylpropyl)amino]-5-nitrophenyl}methylidene)-2-(2-bromophenoxy)acetohydrazide
Chemical Structure Depiction of
N'-({2-[bis(2-methylpropyl)amino]-5-nitrophenyl}methylidene)-2-(2-bromophenoxy)acetohydrazide
N'-({2-[bis(2-methylpropyl)amino]-5-nitrophenyl}methylidene)-2-(2-bromophenoxy)acetohydrazide
Compound characteristics
| Compound ID: | 8005-7607 |
| Compound Name: | N'-({2-[bis(2-methylpropyl)amino]-5-nitrophenyl}methylidene)-2-(2-bromophenoxy)acetohydrazide |
| Molecular Weight: | 505.41 |
| Molecular Formula: | C23 H29 Br N4 O4 |
| Smiles: | CC(C)CN(CC(C)C)c1ccc(cc1/C=N/NC(COc1ccccc1[Br])=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 6.2093 |
| logD: | 6.2092 |
| logSw: | -5.4554 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.294 |
| InChI Key: | ICGXOPCETWVMKE-UHFFFAOYSA-N |