5-bromo-N'-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}pyridine-3-carbohydrazide
Chemical Structure Depiction of
5-bromo-N'-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}pyridine-3-carbohydrazide
5-bromo-N'-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}pyridine-3-carbohydrazide
Compound characteristics
| Compound ID: | 8005-7611 |
| Compound Name: | 5-bromo-N'-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}pyridine-3-carbohydrazide |
| Molecular Weight: | 439.09 |
| Molecular Formula: | C17 H10 Br Cl2 N3 O2 |
| Smiles: | C(\c1ccc(c2ccc(c(c2)[Cl])[Cl])o1)=N/NC(c1cc(cnc1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 5.6048 |
| logD: | 5.5906 |
| logSw: | -6.1824 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.731 |
| InChI Key: | LLGJTWLBXJPEBR-UHFFFAOYSA-N |