N'-({2-[bis(2-methylpropyl)amino]-5-nitrophenyl}methylidene)-2-(2-methoxyphenoxy)acetohydrazide
Chemical Structure Depiction of
N'-({2-[bis(2-methylpropyl)amino]-5-nitrophenyl}methylidene)-2-(2-methoxyphenoxy)acetohydrazide
N'-({2-[bis(2-methylpropyl)amino]-5-nitrophenyl}methylidene)-2-(2-methoxyphenoxy)acetohydrazide
Compound characteristics
| Compound ID: | 8005-7651 |
| Compound Name: | N'-({2-[bis(2-methylpropyl)amino]-5-nitrophenyl}methylidene)-2-(2-methoxyphenoxy)acetohydrazide |
| Molecular Weight: | 456.54 |
| Molecular Formula: | C24 H32 N4 O5 |
| Smiles: | CC(C)CN(CC(C)C)c1ccc(cc1/C=N/NC(COc1ccccc1OC)=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 5.367 |
| logD: | 5.367 |
| logSw: | -5.3263 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 86.924 |
| InChI Key: | JPQVDONUERTTJM-UHFFFAOYSA-N |