N'-(2-bromo-3-phenylprop-2-en-1-ylidene)-2-(2,6-dimethylphenoxy)acetohydrazide
Chemical Structure Depiction of
N'-(2-bromo-3-phenylprop-2-en-1-ylidene)-2-(2,6-dimethylphenoxy)acetohydrazide
N'-(2-bromo-3-phenylprop-2-en-1-ylidene)-2-(2,6-dimethylphenoxy)acetohydrazide
Compound characteristics
| Compound ID: | 8005-7664 |
| Compound Name: | N'-(2-bromo-3-phenylprop-2-en-1-ylidene)-2-(2,6-dimethylphenoxy)acetohydrazide |
| Molecular Weight: | 387.27 |
| Molecular Formula: | C19 H19 Br N2 O2 |
| Smiles: | Cc1cccc(C)c1OCC(N/N=C/C(=C/c1ccccc1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 5.168 |
| logD: | 5.1647 |
| logSw: | -5.0813 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.013 |
| InChI Key: | SUBPCTXRAJTAGG-UHFFFAOYSA-N |