N'-[(5-chloro-2-methoxyphenyl)methylidene]-2-(2,4-dichlorophenoxy)acetohydrazide
Chemical Structure Depiction of
N'-[(5-chloro-2-methoxyphenyl)methylidene]-2-(2,4-dichlorophenoxy)acetohydrazide
N'-[(5-chloro-2-methoxyphenyl)methylidene]-2-(2,4-dichlorophenoxy)acetohydrazide
Compound characteristics
| Compound ID: | 8005-7701 |
| Compound Name: | N'-[(5-chloro-2-methoxyphenyl)methylidene]-2-(2,4-dichlorophenoxy)acetohydrazide |
| Molecular Weight: | 387.65 |
| Molecular Formula: | C16 H13 Cl3 N2 O3 |
| Smiles: | COc1ccc(cc1/C=N/NC(COc1ccc(cc1[Cl])[Cl])=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.8697 |
| logD: | 4.8691 |
| logSw: | -4.8698 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.557 |
| InChI Key: | JNUHQVVQEDTEMO-UHFFFAOYSA-N |