N-(3-{2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl}-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl)benzamide
Chemical Structure Depiction of
N-(3-{2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl}-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl)benzamide
N-(3-{2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl}-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl)benzamide
Compound characteristics
| Compound ID: | 8005-7721 |
| Compound Name: | N-(3-{2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl}-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl)benzamide |
| Molecular Weight: | 579.49 |
| Molecular Formula: | C29 H31 Br N4 O4 |
| Smiles: | CCN(CC)c1ccc(\C=C(/C(N/N=C/c2cc(c(c(c2)[Br])O)OCC)=O)NC(c2ccccc2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.6964 |
| logD: | 3.8224 |
| logSw: | -5.3145 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 82.904 |
| InChI Key: | HTICVFYBVOHKGR-UHFFFAOYSA-N |