2,2-diphenyl-N-(pyridin-3-yl)acetamide
Chemical Structure Depiction of
2,2-diphenyl-N-(pyridin-3-yl)acetamide
2,2-diphenyl-N-(pyridin-3-yl)acetamide
Compound characteristics
| Compound ID: | 8005-8369 |
| Compound Name: | 2,2-diphenyl-N-(pyridin-3-yl)acetamide |
| Molecular Weight: | 288.35 |
| Molecular Formula: | C19 H16 N2 O |
| Smiles: | c1ccc(cc1)C(C(Nc1cccnc1)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.5064 |
| logD: | 3.5058 |
| logSw: | -3.2863 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.576 |
| InChI Key: | ZLDWLMKZVCUCBB-UHFFFAOYSA-N |