butyl 4-(3-fluorophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
butyl 4-(3-fluorophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
butyl 4-(3-fluorophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | 8005-8922 |
| Compound Name: | butyl 4-(3-fluorophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 306.33 |
| Molecular Formula: | C16 H19 F N2 O3 |
| Smiles: | CCCCOC(C1C(c2cccc(c2)F)NC(NC=1C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7146 |
| logD: | 2.5643 |
| logSw: | -2.9887 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.739 |
| InChI Key: | RJSIHOJDLPPLTI-AWEZNQCLSA-N |