N-(3-chloro-4-methylphenyl)-4-(4-chlorophenyl)-1,3-thiazol-2-amine--hydrogen bromide (1/1)
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-4-(4-chlorophenyl)-1,3-thiazol-2-amine--hydrogen bromide (1/1)
N-(3-chloro-4-methylphenyl)-4-(4-chlorophenyl)-1,3-thiazol-2-amine--hydrogen bromide (1/1)
Compound characteristics
| Compound ID: | 8005-9178 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-4-(4-chlorophenyl)-1,3-thiazol-2-amine--hydrogen bromide (1/1) |
| Molecular Weight: | 416.16 |
| Molecular Formula: | C16 H12 Cl2 N2 S |
| Salt: | HBr |
| Smiles: | Cc1ccc(cc1[Cl])Nc1nc(cs1)c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 7.271 |
| logD: | 7.271 |
| logSw: | -6.8328 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 18.9257 |
| InChI Key: | HFGGRGPCZCQQKC-UHFFFAOYSA-N |