1-(3-chlorophenyl)-3-[4-(2-chlorophenyl)piperazin-1-yl]pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-(3-chlorophenyl)-3-[4-(2-chlorophenyl)piperazin-1-yl]pyrrolidine-2,5-dione
1-(3-chlorophenyl)-3-[4-(2-chlorophenyl)piperazin-1-yl]pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | 8005-9183 |
| Compound Name: | 1-(3-chlorophenyl)-3-[4-(2-chlorophenyl)piperazin-1-yl]pyrrolidine-2,5-dione |
| Molecular Weight: | 404.29 |
| Molecular Formula: | C20 H19 Cl2 N3 O2 |
| Smiles: | C1C(C(N(C1=O)c1cccc(c1)[Cl])=O)N1CCN(CC1)c1ccccc1[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.171 |
| logD: | 3.171 |
| logSw: | -3.3637 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 34.947 |
| InChI Key: | VYGVEUBWYPYNTO-SFHVURJKSA-N |