N~2~-(benzenesulfonyl)-N-(2-ethylphenyl)-N~2~-[3-(trifluoromethyl)phenyl]glycinamide
Chemical Structure Depiction of
N~2~-(benzenesulfonyl)-N-(2-ethylphenyl)-N~2~-[3-(trifluoromethyl)phenyl]glycinamide
N~2~-(benzenesulfonyl)-N-(2-ethylphenyl)-N~2~-[3-(trifluoromethyl)phenyl]glycinamide
Compound characteristics
| Compound ID: | 8005-9471 |
| Compound Name: | N~2~-(benzenesulfonyl)-N-(2-ethylphenyl)-N~2~-[3-(trifluoromethyl)phenyl]glycinamide |
| Molecular Weight: | 462.49 |
| Molecular Formula: | C23 H21 F3 N2 O3 S |
| Smiles: | CCc1ccccc1NC(CN(c1cccc(c1)C(F)(F)F)S(c1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2188 |
| logD: | 5.2188 |
| logSw: | -5.0303 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.244 |
| InChI Key: | XIQJPBITKFGBFJ-UHFFFAOYSA-N |