6-benzyl-3-(methylsulfanyl)-1,2,4-triazin-5(2H)-one
Chemical Structure Depiction of
6-benzyl-3-(methylsulfanyl)-1,2,4-triazin-5(2H)-one
6-benzyl-3-(methylsulfanyl)-1,2,4-triazin-5(2H)-one
Compound characteristics
| Compound ID: | 8005-9612 |
| Compound Name: | 6-benzyl-3-(methylsulfanyl)-1,2,4-triazin-5(2H)-one |
| Molecular Weight: | 233.29 |
| Molecular Formula: | C11 H11 N3 O S |
| Smiles: | CSC1NN=C(Cc2ccccc2)C(N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.895 |
| logD: | 1.0581 |
| logSw: | -2.2057 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.19 |
| InChI Key: | UZKXPIHJBZEOAR-UHFFFAOYSA-N |