1-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)methanimine
Chemical Structure Depiction of
1-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)methanimine
1-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)methanimine
Compound characteristics
| Compound ID: | 8006-1049 |
| Compound Name: | 1-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)methanimine |
| Molecular Weight: | 233.25 |
| Molecular Formula: | C10 H7 N3 O2 S |
| Smiles: | C(\c1ccc(cc1)[N+]([O-])=O)=N/c1nccs1 |
| Stereo: | ACHIRAL |
| logP: | 2.3408 |
| logD: | 2.3408 |
| logSw: | -2.4607 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.226 |
| InChI Key: | PHLFPZFOJXHXPC-UHFFFAOYSA-N |