2-{[4-(dimethylamino)phenyl]methylidene}-N-phenylhydrazine-1-carbothioamide
Chemical Structure Depiction of
2-{[4-(dimethylamino)phenyl]methylidene}-N-phenylhydrazine-1-carbothioamide
2-{[4-(dimethylamino)phenyl]methylidene}-N-phenylhydrazine-1-carbothioamide
Compound characteristics
| Compound ID: | 8006-1103 |
| Compound Name: | 2-{[4-(dimethylamino)phenyl]methylidene}-N-phenylhydrazine-1-carbothioamide |
| Molecular Weight: | 298.41 |
| Molecular Formula: | C16 H18 N4 S |
| Smiles: | CN(C)c1ccc(/C=N/NC(Nc2ccccc2)=S)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.8568 |
| logD: | 3.8567 |
| logSw: | -4.0735 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 34.09 |
| InChI Key: | HBLLYJOWYYMLSE-UHFFFAOYSA-N |