5'-bromo-1'-(2-methylprop-2-en-1-yl)spiro[[1,3]dioxolane-2,3'-indol]-2'(1'H)-one
Chemical Structure Depiction of
5'-bromo-1'-(2-methylprop-2-en-1-yl)spiro[[1,3]dioxolane-2,3'-indol]-2'(1'H)-one
5'-bromo-1'-(2-methylprop-2-en-1-yl)spiro[[1,3]dioxolane-2,3'-indol]-2'(1'H)-one
Compound characteristics
| Compound ID: | 8006-1472 |
| Compound Name: | 5'-bromo-1'-(2-methylprop-2-en-1-yl)spiro[[1,3]dioxolane-2,3'-indol]-2'(1'H)-one |
| Molecular Weight: | 324.17 |
| Molecular Formula: | C14 H14 Br N O3 |
| Smiles: | CC(=C)CN1C(C2(c3cc(ccc13)[Br])OCCO2)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3286 |
| logD: | 3.3286 |
| logSw: | -3.6457 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.879 |
| InChI Key: | UQWJPWFCSFVFKR-UHFFFAOYSA-N |