N'-benzylidene-2-(2-methoxy-4,6-dinitrophenoxy)acetohydrazide
Chemical Structure Depiction of
N'-benzylidene-2-(2-methoxy-4,6-dinitrophenoxy)acetohydrazide
N'-benzylidene-2-(2-methoxy-4,6-dinitrophenoxy)acetohydrazide
Compound characteristics
| Compound ID: | 8006-1729 |
| Compound Name: | N'-benzylidene-2-(2-methoxy-4,6-dinitrophenoxy)acetohydrazide |
| Molecular Weight: | 374.31 |
| Molecular Formula: | C16 H14 N4 O7 |
| Smiles: | COc1cc(cc(c1OCC(N/N=C/c1ccccc1)=O)[N+]([O-])=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 2.3838 |
| logD: | 2.3835 |
| logSw: | -3.0256 |
| Hydrogen bond acceptors count: | 13 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 117.106 |
| InChI Key: | YCLBXOFVFUNQQA-UHFFFAOYSA-N |