4-({2-[(2-nitrophenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-iodobenzoate
Chemical Structure Depiction of
4-({2-[(2-nitrophenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-iodobenzoate
4-({2-[(2-nitrophenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-iodobenzoate
Compound characteristics
| Compound ID: | 8006-1963 |
| Compound Name: | 4-({2-[(2-nitrophenoxy)acetyl]hydrazinylidene}methyl)phenyl 2-iodobenzoate |
| Molecular Weight: | 545.29 |
| Molecular Formula: | C22 H16 I N3 O6 |
| Smiles: | C(C(N/N=C/c1ccc(cc1)OC(c1ccccc1I)=O)=O)Oc1ccccc1[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 4.242 |
| logD: | 4.2417 |
| logSw: | -4.5269 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 96.385 |
| InChI Key: | DZLVHZQVONMOSZ-UHFFFAOYSA-N |