4-[(2-{2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl}hydrazinylidene)methyl]-2-ethoxyphenyl 4-bromobenzoate
Chemical Structure Depiction of
4-[(2-{2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl}hydrazinylidene)methyl]-2-ethoxyphenyl 4-bromobenzoate
4-[(2-{2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl}hydrazinylidene)methyl]-2-ethoxyphenyl 4-bromobenzoate
Compound characteristics
| Compound ID: | 8006-2078 |
| Compound Name: | 4-[(2-{2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl}hydrazinylidene)methyl]-2-ethoxyphenyl 4-bromobenzoate |
| Molecular Weight: | 655.55 |
| Molecular Formula: | C34 H31 Br N4 O5 |
| Smiles: | CCOc1cc(/C=N/NC(/C(=C\c2ccc(cc2)N(C)C)NC(c2ccccc2)=O)=O)ccc1OC(c1ccc(cc1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 6.3898 |
| logD: | 4.5158 |
| logSw: | -5.7585 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 87.958 |
| InChI Key: | YMFYAGRLAKCOKH-UHFFFAOYSA-N |