4-({2-[(2,6-dimethylphenoxy)acetyl]hydrazinylidene}methyl)-2-methoxyphenyl 2-chlorobenzoate
Chemical Structure Depiction of
4-({2-[(2,6-dimethylphenoxy)acetyl]hydrazinylidene}methyl)-2-methoxyphenyl 2-chlorobenzoate
4-({2-[(2,6-dimethylphenoxy)acetyl]hydrazinylidene}methyl)-2-methoxyphenyl 2-chlorobenzoate
Compound characteristics
| Compound ID: | 8006-2085 |
| Compound Name: | 4-({2-[(2,6-dimethylphenoxy)acetyl]hydrazinylidene}methyl)-2-methoxyphenyl 2-chlorobenzoate |
| Molecular Weight: | 466.92 |
| Molecular Formula: | C25 H23 Cl N2 O5 |
| Smiles: | Cc1cccc(C)c1OCC(N/N=C/c1ccc(c(c1)OC)OC(c1ccccc1[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7207 |
| logD: | 5.7205 |
| logSw: | -5.8539 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.108 |
| InChI Key: | GVLQYYNHQDXOJV-UHFFFAOYSA-N |