4-bromo-2-({2-[(4-chlorophenoxy)acetyl]hydrazinylidene}methyl)phenyl 4-bromobenzoate
Chemical Structure Depiction of
4-bromo-2-({2-[(4-chlorophenoxy)acetyl]hydrazinylidene}methyl)phenyl 4-bromobenzoate
4-bromo-2-({2-[(4-chlorophenoxy)acetyl]hydrazinylidene}methyl)phenyl 4-bromobenzoate
Compound characteristics
| Compound ID: | 8006-2093 |
| Compound Name: | 4-bromo-2-({2-[(4-chlorophenoxy)acetyl]hydrazinylidene}methyl)phenyl 4-bromobenzoate |
| Molecular Weight: | 566.63 |
| Molecular Formula: | C22 H15 Br2 Cl N2 O4 |
| Smiles: | C(C(N/N=C/c1cc(ccc1OC(c1ccc(cc1)[Br])=O)[Br])=O)Oc1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.3723 |
| logD: | 6.3678 |
| logSw: | -6.5416 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.304 |
| InChI Key: | YFYFCXRVTVARBJ-UHFFFAOYSA-N |