2-{2-[(4-chlorophenyl)methylidene]hydrazinyl}-4-phenyl-1,3-thiazole
Chemical Structure Depiction of
2-{2-[(4-chlorophenyl)methylidene]hydrazinyl}-4-phenyl-1,3-thiazole
2-{2-[(4-chlorophenyl)methylidene]hydrazinyl}-4-phenyl-1,3-thiazole
Compound characteristics
| Compound ID: | 8006-3728 |
| Compound Name: | 2-{2-[(4-chlorophenyl)methylidene]hydrazinyl}-4-phenyl-1,3-thiazole |
| Molecular Weight: | 313.81 |
| Molecular Formula: | C16 H12 Cl N3 S |
| Smiles: | C(\c1ccc(cc1)[Cl])=N/Nc1nc(cs1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.677 |
| logD: | 5.677 |
| logSw: | -6.4683 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.1502 |
| InChI Key: | YQKYELGBAMTOTP-UHFFFAOYSA-N |