4-(morpholine-4-carbothioyl)phenyl 4-bromobenzoate
Chemical Structure Depiction of
4-(morpholine-4-carbothioyl)phenyl 4-bromobenzoate
4-(morpholine-4-carbothioyl)phenyl 4-bromobenzoate
Compound characteristics
| Compound ID: | 8006-3814 |
| Compound Name: | 4-(morpholine-4-carbothioyl)phenyl 4-bromobenzoate |
| Molecular Weight: | 406.3 |
| Molecular Formula: | C18 H16 Br N O3 S |
| Smiles: | C1COCCN1C(c1ccc(cc1)OC(c1ccc(cc1)[Br])=O)=S |
| Stereo: | ACHIRAL |
| logP: | 4.16 |
| logD: | 4.16 |
| logSw: | -4.2474 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 30.4732 |
| InChI Key: | IFMOJBRIJWIKGE-UHFFFAOYSA-N |