2-oxo-2-phenylethyl 4-(3,4-dichloroanilino)-4-oxobutanoate
Chemical Structure Depiction of
2-oxo-2-phenylethyl 4-(3,4-dichloroanilino)-4-oxobutanoate
2-oxo-2-phenylethyl 4-(3,4-dichloroanilino)-4-oxobutanoate
Compound characteristics
| Compound ID: | 8006-3832 |
| Compound Name: | 2-oxo-2-phenylethyl 4-(3,4-dichloroanilino)-4-oxobutanoate |
| Molecular Weight: | 380.23 |
| Molecular Formula: | C18 H15 Cl2 N O4 |
| Smiles: | C(CC(=O)OCC(c1ccccc1)=O)C(Nc1ccc(c(c1)[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.8598 |
| logD: | 3.8419 |
| logSw: | -4.1958 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.897 |
| InChI Key: | NUWXZBQBTRXXIO-UHFFFAOYSA-N |