6-(2-{[5-(2,4-dichlorophenyl)furan-2-yl]methylidene}hydrazinyl)-N~2~-[(furan-2-yl)methyl]-N~4~-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine
Chemical Structure Depiction of
6-(2-{[5-(2,4-dichlorophenyl)furan-2-yl]methylidene}hydrazinyl)-N~2~-[(furan-2-yl)methyl]-N~4~-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine
6-(2-{[5-(2,4-dichlorophenyl)furan-2-yl]methylidene}hydrazinyl)-N~2~-[(furan-2-yl)methyl]-N~4~-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine
Compound characteristics
| Compound ID: | 8006-4087 |
| Compound Name: | 6-(2-{[5-(2,4-dichlorophenyl)furan-2-yl]methylidene}hydrazinyl)-N~2~-[(furan-2-yl)methyl]-N~4~-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
| Molecular Weight: | 550.4 |
| Molecular Formula: | C26 H21 Cl2 N7 O3 |
| Smiles: | COc1ccc(cc1)Nc1nc(NCc2ccco2)nc(N/N=C/c2ccc(c3ccc(cc3[Cl])[Cl])o2)n1 |
| Stereo: | ACHIRAL |
| logP: | 8.316 |
| logD: | 8.3156 |
| logSw: | -6.7596 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 96.654 |
| InChI Key: | IUDIZWOAUDJQNU-UHFFFAOYSA-N |