Nalpha-(tert-butoxycarbonyl)-N-ethyltryptophanamide
Chemical Structure Depiction of
Nalpha-(tert-butoxycarbonyl)-N-ethyltryptophanamide
Nalpha-(tert-butoxycarbonyl)-N-ethyltryptophanamide
Compound characteristics
| Compound ID: | 8006-4102 |
| Compound Name: | Nalpha-(tert-butoxycarbonyl)-N-ethyltryptophanamide |
| Molecular Weight: | 331.41 |
| Molecular Formula: | C18 H25 N3 O3 |
| Smiles: | CCNC(C(Cc1c[nH]c2ccccc12)NC(=O)OC(C)(C)C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4176 |
| logD: | 3.4176 |
| logSw: | -3.5015 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 65.926 |
| InChI Key: | IRPWZSMPFPXQNN-HNNXBMFYSA-N |