N-{1-[1-(3-methylphenyl)-1H-tetrazol-5-yl]cyclohexyl}-1-(4-nitrophenyl)methanimine
Chemical Structure Depiction of
N-{1-[1-(3-methylphenyl)-1H-tetrazol-5-yl]cyclohexyl}-1-(4-nitrophenyl)methanimine
N-{1-[1-(3-methylphenyl)-1H-tetrazol-5-yl]cyclohexyl}-1-(4-nitrophenyl)methanimine
Compound characteristics
| Compound ID: | 8006-5619 |
| Compound Name: | N-{1-[1-(3-methylphenyl)-1H-tetrazol-5-yl]cyclohexyl}-1-(4-nitrophenyl)methanimine |
| Molecular Weight: | 390.44 |
| Molecular Formula: | C21 H22 N6 O2 |
| Smiles: | Cc1cccc(c1)n1c(C2(CCCCC2)/N=C/c2ccc(cc2)[N+]([O-])=O)nnn1 |
| Stereo: | ACHIRAL |
| logP: | 4.7962 |
| logD: | 4.7961 |
| logSw: | -4.5909 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 81.902 |
| InChI Key: | XITWUNYSBARHBE-UHFFFAOYSA-N |