N-(6-chlorohexyl)-N'-(2-hydroxyphenyl)urea
Chemical Structure Depiction of
N-(6-chlorohexyl)-N'-(2-hydroxyphenyl)urea
N-(6-chlorohexyl)-N'-(2-hydroxyphenyl)urea
Compound characteristics
| Compound ID: | 8006-5760 |
| Compound Name: | N-(6-chlorohexyl)-N'-(2-hydroxyphenyl)urea |
| Molecular Weight: | 270.76 |
| Molecular Formula: | C13 H19 Cl N2 O2 |
| Smiles: | C(CCC[Cl])CCNC(Nc1ccccc1O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.106 |
| logD: | 3.1053 |
| logSw: | -3.1078 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 49.827 |
| InChI Key: | MPPJKPIDTCAETL-UHFFFAOYSA-N |