2-{[4-(4-chlorophenyl)-3-cyano-6-cyclopropylpyridin-2-yl]sulfanyl}acetamide
Chemical Structure Depiction of
2-{[4-(4-chlorophenyl)-3-cyano-6-cyclopropylpyridin-2-yl]sulfanyl}acetamide
2-{[4-(4-chlorophenyl)-3-cyano-6-cyclopropylpyridin-2-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | 8006-5811 |
| Compound Name: | 2-{[4-(4-chlorophenyl)-3-cyano-6-cyclopropylpyridin-2-yl]sulfanyl}acetamide |
| Molecular Weight: | 343.83 |
| Molecular Formula: | C17 H14 Cl N3 O S |
| Smiles: | C1CC1c1cc(c2ccc(cc2)[Cl])c(C#N)c(n1)SCC(N)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1228 |
| logD: | 4.1228 |
| logSw: | -4.87 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.41 |
| InChI Key: | LUCJQVRNFJKNGE-UHFFFAOYSA-N |