N-(3-{2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinecarbonyl}phenyl)pentanamide
Chemical Structure Depiction of
N-(3-{2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinecarbonyl}phenyl)pentanamide
N-(3-{2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinecarbonyl}phenyl)pentanamide
Compound characteristics
| Compound ID: | 8006-5990 |
| Compound Name: | N-(3-{2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinecarbonyl}phenyl)pentanamide |
| Molecular Weight: | 418.29 |
| Molecular Formula: | C19 H20 Br N3 O3 |
| Smiles: | CCCCC(Nc1cccc(c1)C(N/N=C/c1cc(ccc1O)[Br])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6016 |
| logD: | 4.5061 |
| logSw: | -4.1069 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 75.252 |
| InChI Key: | QYUPMRDNVOVDKA-CIAFOILYSA-N |