N-(3-methoxy-5-nitrophenyl)-2-(2-methylphenoxy)acetamide
Chemical Structure Depiction of
N-(3-methoxy-5-nitrophenyl)-2-(2-methylphenoxy)acetamide
N-(3-methoxy-5-nitrophenyl)-2-(2-methylphenoxy)acetamide
Compound characteristics
| Compound ID: | 8006-6127 |
| Compound Name: | N-(3-methoxy-5-nitrophenyl)-2-(2-methylphenoxy)acetamide |
| Molecular Weight: | 316.31 |
| Molecular Formula: | C16 H16 N2 O5 |
| Smiles: | Cc1ccccc1OCC(Nc1cc(cc(c1)OC)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7637 |
| logD: | 3.7544 |
| logSw: | -4.0886 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.627 |
| InChI Key: | CIFZZBCWRDRSKG-UHFFFAOYSA-N |