N-[4-([1,1'-biphenyl]-4-yl)-5-methyl-1,3-thiazol-2-yl]-2-oxo-2H-1-benzopyran-3-carboxamide
Chemical Structure Depiction of
N-[4-([1,1'-biphenyl]-4-yl)-5-methyl-1,3-thiazol-2-yl]-2-oxo-2H-1-benzopyran-3-carboxamide
N-[4-([1,1'-biphenyl]-4-yl)-5-methyl-1,3-thiazol-2-yl]-2-oxo-2H-1-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | 8006-6607 |
| Compound Name: | N-[4-([1,1'-biphenyl]-4-yl)-5-methyl-1,3-thiazol-2-yl]-2-oxo-2H-1-benzopyran-3-carboxamide |
| Molecular Weight: | 438.5 |
| Molecular Formula: | C26 H18 N2 O3 S |
| Smiles: | Cc1c(c2ccc(cc2)c2ccccc2)nc(NC(C2=Cc3ccccc3OC2=O)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 6.1079 |
| logD: | 5.9781 |
| logSw: | -5.7709 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.525 |
| InChI Key: | AKUPPTYXSAKWMZ-UHFFFAOYSA-N |