N-(4-methylphenyl)-3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxamide
Chemical Structure Depiction of
N-(4-methylphenyl)-3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxamide
N-(4-methylphenyl)-3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | 8006-7087 |
| Compound Name: | N-(4-methylphenyl)-3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxamide |
| Molecular Weight: | 310.46 |
| Molecular Formula: | C13 H14 N2 O S3 |
| Smiles: | Cc1ccc(cc1)NC(c1c(nsc1SC)SC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4595 |
| logD: | 4.4593 |
| logSw: | -4.4532 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.953 |
| InChI Key: | PJQCRNVPULKJLV-UHFFFAOYSA-N |