N'-[(2,4-dimethoxyphenyl)methylidene]pyridine-3-carbohydrazide
Chemical Structure Depiction of
N'-[(2,4-dimethoxyphenyl)methylidene]pyridine-3-carbohydrazide
N'-[(2,4-dimethoxyphenyl)methylidene]pyridine-3-carbohydrazide
Compound characteristics
| Compound ID: | 8006-7236 |
| Compound Name: | N'-[(2,4-dimethoxyphenyl)methylidene]pyridine-3-carbohydrazide |
| Molecular Weight: | 285.3 |
| Molecular Formula: | C15 H15 N3 O3 |
| Smiles: | COc1ccc(/C=N/NC(c2cccnc2)=O)c(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 2.1372 |
| logD: | 2.1326 |
| logSw: | -2.486 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.246 |
| InChI Key: | HAEHHRUDKZNWQY-UHFFFAOYSA-N |