ethyl 2-{[4-(ethylamino)-6-phenoxy-1,3,5-triazin-2-yl]oxy}propanoate
Chemical Structure Depiction of
ethyl 2-{[4-(ethylamino)-6-phenoxy-1,3,5-triazin-2-yl]oxy}propanoate
ethyl 2-{[4-(ethylamino)-6-phenoxy-1,3,5-triazin-2-yl]oxy}propanoate
Compound characteristics
| Compound ID: | 8006-8291 |
| Compound Name: | ethyl 2-{[4-(ethylamino)-6-phenoxy-1,3,5-triazin-2-yl]oxy}propanoate |
| Molecular Weight: | 332.36 |
| Molecular Formula: | C16 H20 N4 O4 |
| Smiles: | CCNc1nc(nc(n1)Oc1ccccc1)OC(C)C(=O)OCC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4983 |
| logD: | 3.4983 |
| logSw: | -3.6745 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.263 |
| InChI Key: | WIZAPDKCKXVOMF-NSHDSACASA-N |