3,3'-sulfonylbis(N,N-diethyl-6-methylbenzene-1-sulfonamide)
Chemical Structure Depiction of
3,3'-sulfonylbis(N,N-diethyl-6-methylbenzene-1-sulfonamide)
3,3'-sulfonylbis(N,N-diethyl-6-methylbenzene-1-sulfonamide)
Compound characteristics
| Compound ID: | 8006-8853 |
| Compound Name: | 3,3'-sulfonylbis(N,N-diethyl-6-methylbenzene-1-sulfonamide) |
| Molecular Weight: | 516.7 |
| Molecular Formula: | C22 H32 N2 O6 S3 |
| Smiles: | CCN(CC)S(c1cc(ccc1C)S(c1ccc(C)c(c1)S(N(CC)CC)(=O)=O)(=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1979 |
| logD: | 4.1979 |
| logSw: | -4.1783 |
| Hydrogen bond acceptors count: | 14 |
| Polar surface area: | 91.932 |
| InChI Key: | NASVFFHOOCNGHI-UHFFFAOYSA-N |