N-(2-bromo-4-methylphenyl)-4-{2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl}-6-(morpholin-4-yl)-1,3,5-triazin-2-amine
Chemical Structure Depiction of
N-(2-bromo-4-methylphenyl)-4-{2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl}-6-(morpholin-4-yl)-1,3,5-triazin-2-amine
N-(2-bromo-4-methylphenyl)-4-{2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl}-6-(morpholin-4-yl)-1,3,5-triazin-2-amine
Compound characteristics
| Compound ID: | 8006-9079 |
| Compound Name: | N-(2-bromo-4-methylphenyl)-4-{2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl}-6-(morpholin-4-yl)-1,3,5-triazin-2-amine |
| Molecular Weight: | 528.41 |
| Molecular Formula: | C23 H26 Br N7 O3 |
| Smiles: | Cc1ccc(c(c1)[Br])Nc1nc(N/N=C/c2ccc(c(c2)OC)OC)nc(n1)N1CCOCC1 |
| Stereo: | ACHIRAL |
| logP: | 5.6504 |
| logD: | 5.6493 |
| logSw: | -5.5365 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 87.273 |
| InChI Key: | RELPWZPBBGCJPW-UHFFFAOYSA-N |