2-hydroxy-2-phenyl-N'-[phenyl(1,3,5-triazatricyclo[3.3.1.1~3,7~]decan-7-yl)methylidene]propanehydrazide
Chemical Structure Depiction of
2-hydroxy-2-phenyl-N'-[phenyl(1,3,5-triazatricyclo[3.3.1.1~3,7~]decan-7-yl)methylidene]propanehydrazide
2-hydroxy-2-phenyl-N'-[phenyl(1,3,5-triazatricyclo[3.3.1.1~3,7~]decan-7-yl)methylidene]propanehydrazide
Compound characteristics
| Compound ID: | 8006-9283 |
| Compound Name: | 2-hydroxy-2-phenyl-N'-[phenyl(1,3,5-triazatricyclo[3.3.1.1~3,7~]decan-7-yl)methylidene]propanehydrazide |
| Molecular Weight: | 405.5 |
| Molecular Formula: | C23 H27 N5 O2 |
| Smiles: | CC(C(N/N=C(\c1ccccc1)C12CN3CN(C1)CN(C2)C3)=O)(c1ccccc1)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8119 |
| logD: | 2.7843 |
| logSw: | -3.0905 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.986 |
| InChI Key: | SFNBLHCNKHHVKA-JOCHJYFZSA-N |