4-({2-[(4-fluorobenzamido)acetyl]hydrazinylidene}methyl)phenyl thiophene-2-carboxylate
Chemical Structure Depiction of
4-({2-[(4-fluorobenzamido)acetyl]hydrazinylidene}methyl)phenyl thiophene-2-carboxylate
4-({2-[(4-fluorobenzamido)acetyl]hydrazinylidene}methyl)phenyl thiophene-2-carboxylate
Compound characteristics
| Compound ID: | 8006-9302 |
| Compound Name: | 4-({2-[(4-fluorobenzamido)acetyl]hydrazinylidene}methyl)phenyl thiophene-2-carboxylate |
| Molecular Weight: | 425.44 |
| Molecular Formula: | C21 H16 F N3 O4 S |
| Smiles: | C(C(N/N=C/c1ccc(cc1)OC(c1cccs1)=O)=O)NC(c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5051 |
| logD: | 3.5049 |
| logSw: | -3.7503 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 81.422 |
| InChI Key: | YUNYNLURNFUGRH-UHFFFAOYSA-N |