N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(piperidine-1-sulfonyl)benzamide
Chemical Structure Depiction of
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(piperidine-1-sulfonyl)benzamide
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(piperidine-1-sulfonyl)benzamide
Compound characteristics
| Compound ID: | 8006-9350 |
| Compound Name: | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(piperidine-1-sulfonyl)benzamide |
| Molecular Weight: | 429.56 |
| Molecular Formula: | C21 H23 N3 O3 S2 |
| Smiles: | C1CCN(CC1)S(c1cccc(c1)C(Nc1c(C#N)c2CCCCc2s1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8552 |
| logD: | 0.592 |
| logSw: | -4.2693 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.812 |
| InChI Key: | WWOFWAKZSCRUMO-UHFFFAOYSA-N |