2,4-dibromo-6-({2-[4-(3-chloro-4-methylanilino)-6-(morpholin-4-yl)-1,3,5-triazin-2-yl]hydrazinylidene}methyl)phenol--acetic acid (1/1)
Chemical Structure Depiction of
2,4-dibromo-6-({2-[4-(3-chloro-4-methylanilino)-6-(morpholin-4-yl)-1,3,5-triazin-2-yl]hydrazinylidene}methyl)phenol--acetic acid (1/1)
2,4-dibromo-6-({2-[4-(3-chloro-4-methylanilino)-6-(morpholin-4-yl)-1,3,5-triazin-2-yl]hydrazinylidene}methyl)phenol--acetic acid (1/1)
Compound characteristics
| Compound ID: | 8007-0065 |
| Compound Name: | 2,4-dibromo-6-({2-[4-(3-chloro-4-methylanilino)-6-(morpholin-4-yl)-1,3,5-triazin-2-yl]hydrazinylidene}methyl)phenol--acetic acid (1/1) |
| Molecular Weight: | 657.75 |
| Molecular Formula: | C21 H20 Br2 Cl N7 O2 |
| Salt: | CH3COOH |
| Smiles: | Cc1ccc(cc1[Cl])Nc1nc(N/N=C/c2cc(cc(c2O)[Br])[Br])nc(n1)N1CCOCC1 |
| Stereo: | ACHIRAL |
| logP: | 7.8399 |
| logD: | 7.7351 |
| logSw: | -6.1813 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 88.19 |
| InChI Key: | GGNLKUAQURGZOJ-OPEKNORGSA-N |