2-{[(2-chlorophenyl)methyl]sulfanyl}-4-(2-methoxyphenyl)-6-phenylpyridine-3-carbonitrile
Chemical Structure Depiction of
2-{[(2-chlorophenyl)methyl]sulfanyl}-4-(2-methoxyphenyl)-6-phenylpyridine-3-carbonitrile
2-{[(2-chlorophenyl)methyl]sulfanyl}-4-(2-methoxyphenyl)-6-phenylpyridine-3-carbonitrile
Compound characteristics
| Compound ID: | 8007-0185 |
| Compound Name: | 2-{[(2-chlorophenyl)methyl]sulfanyl}-4-(2-methoxyphenyl)-6-phenylpyridine-3-carbonitrile |
| Molecular Weight: | 442.97 |
| Molecular Formula: | C26 H19 Cl N2 O S |
| Smiles: | COc1ccccc1c1cc(c2ccccc2)nc(c1C#N)SCc1ccccc1[Cl] |
| Stereo: | ACHIRAL |
| logP: | 7.4805 |
| logD: | 7.4805 |
| logSw: | -6.6603 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.858 |
| InChI Key: | QIGYMGQSSIDDJI-UHFFFAOYSA-N |