4-(3-fluorophenyl)-2-[(3-phenoxypropyl)sulfanyl]-6-(thiophen-2-yl)pyridine-3-carbonitrile
Chemical Structure Depiction of
4-(3-fluorophenyl)-2-[(3-phenoxypropyl)sulfanyl]-6-(thiophen-2-yl)pyridine-3-carbonitrile
4-(3-fluorophenyl)-2-[(3-phenoxypropyl)sulfanyl]-6-(thiophen-2-yl)pyridine-3-carbonitrile
Compound characteristics
| Compound ID: | 8007-0195 |
| Compound Name: | 4-(3-fluorophenyl)-2-[(3-phenoxypropyl)sulfanyl]-6-(thiophen-2-yl)pyridine-3-carbonitrile |
| Molecular Weight: | 446.56 |
| Molecular Formula: | C25 H19 F N2 O S2 |
| Smiles: | C(COc1ccccc1)CSc1c(C#N)c(cc(c2cccs2)n1)c1cccc(c1)F |
| Stereo: | ACHIRAL |
| logP: | 7.4612 |
| logD: | 7.4612 |
| logSw: | -6.3299 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.663 |
| InChI Key: | VNCNSSLTIXGCAH-UHFFFAOYSA-N |