4-(4-fluorophenyl)-2-[(2-phenoxyethyl)sulfanyl]-6-phenylpyridine-3-carbonitrile
Chemical Structure Depiction of
4-(4-fluorophenyl)-2-[(2-phenoxyethyl)sulfanyl]-6-phenylpyridine-3-carbonitrile
4-(4-fluorophenyl)-2-[(2-phenoxyethyl)sulfanyl]-6-phenylpyridine-3-carbonitrile
Compound characteristics
| Compound ID: | 8007-0216 |
| Compound Name: | 4-(4-fluorophenyl)-2-[(2-phenoxyethyl)sulfanyl]-6-phenylpyridine-3-carbonitrile |
| Molecular Weight: | 426.51 |
| Molecular Formula: | C26 H19 F N2 O S |
| Smiles: | C(CSc1c(C#N)c(cc(c2ccccc2)n1)c1ccc(cc1)F)Oc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 7.1077 |
| logD: | 7.1077 |
| logSw: | -6.3731 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.645 |
| InChI Key: | GORWTVNFGXRIIH-UHFFFAOYSA-N |