5-(2-chlorophenyl)-3-{[3-(trifluoromethyl)anilino]methyl}-1,3,4-oxadiazole-2(3H)-thione
Chemical Structure Depiction of
5-(2-chlorophenyl)-3-{[3-(trifluoromethyl)anilino]methyl}-1,3,4-oxadiazole-2(3H)-thione
5-(2-chlorophenyl)-3-{[3-(trifluoromethyl)anilino]methyl}-1,3,4-oxadiazole-2(3H)-thione
Compound characteristics
| Compound ID: | 8007-0962 |
| Compound Name: | 5-(2-chlorophenyl)-3-{[3-(trifluoromethyl)anilino]methyl}-1,3,4-oxadiazole-2(3H)-thione |
| Molecular Weight: | 385.79 |
| Molecular Formula: | C16 H11 Cl F3 N3 O S |
| Smiles: | C(Nc1cccc(c1)C(F)(F)F)N1C(OC(c2ccccc2[Cl])=N1)=S |
| Stereo: | ACHIRAL |
| logP: | 5.1007 |
| logD: | 5.1007 |
| logSw: | -5.3369 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.348 |
| InChI Key: | AIIGTIGOKSHEEB-UHFFFAOYSA-N |